EPEG601 PCE Monomer

TDS:
Molecular formula: CH2=CHO(CH2)mO(CH2CH2O)nH
Appearance: White or slightly yellow flakes
PH Value (1% aqueous solution): 8-11
Hydroxyl Value: 18.5～20.5 mgKOH/g
Degree of unsaturation: ≥0.3
Double bond retention: ≥88%
Molecular weight: approximately 3000
Moisture: ≤ 1%
Acid value: ≤ 0.5 mgKOH/g

Product advantages:
1. High comprehensive performance
2. Low/Normal temperature process
3. Most be suitable for various engineering projects

Storage and transportation:
1. Handle according to general chemical transportation regulations
2. Store in a dry and ventilated place
3. Avoid exposure to sunlight and rain

Product shelf life: 2 Years

Packing: 25㎏ plastic woven bag packing

Product Images: 

Parameter Table Download:

TDS_EPEG601.pdf